| Pharmaceutical Information |
| Drug Name |
Pentosan polysulfate |
| Drug ID |
BADD_D01728 |
| Description |
Pentosan polysulfate is a sulfated pentosyl polysaccharide with heparin-like properties. |
| Indications and Usage |
For the relief of bladder pain or discomfort associated with interstitial cystitis. |
| Marketing Status |
approved |
| ATC Code |
G04BX15; C05BA04 |
| DrugBank ID |
DB00686
|
| KEGG ID |
D05428
|
| MeSH ID |
D010426
|
| PubChem ID |
37720
|
| TTD Drug ID |
D0F8CM
|
| NDC Product Code |
Not Available |
| UNII |
F59P8B75R4
|
| Synonyms |
Pentosan Sulfuric Polyester | Polyester, Pentosan Sulfuric | Sulfuric Polyester, Pentosan | Pentosane Sulfuric Polyester | Polyester, Pentosane Sulfuric | Sulfuric Polyester, Pentosane | Xylan Sulfate | Sulfate, Xylan | Polypentose Sulfate | Sulfate, Polypentose | Polysulfated Xylan | Xylan, Polysulfated | Fibrocid | Hemoclar | HOE-BAY-946 | HOE BAY 946 | HOE-BAY 946 | BAY-946 | BAY 946 | HOE-946 | HOE 946 | Xylan SP54 | SP54, Xylan | Pentosan Polysulphate Sodium | Polysulphate Sodium, Pentosan | Sodium, Pentosan Polysulphate | Pentosan Polysulfate Sodium | Polysulfate Sodium, Pentosan | Sodium, Pentosan Polysulfate | PZ-68 | PZ 68 | PZ68 | SP-54 | SP 54 | SP54 | Tavan SP 54 | SP 54, Tavan | Elmiron | Pentosan Polysulfate | Polysulfate, Pentosan |
|
| Chemical Information |
| Molecular Formula |
C10H18O21S4 |
| CAS Registry Number |
37300-21-3 |
| SMILES |
C1C(C(C(C(O1)OC2COC(C(C2OS(=O)(=O)O)OS(=O)(=O)O)O)OS(=O)(=O)O)OS(=O)(=O)O)O |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice..
|
|
|