| Pharmaceutical Information |
| Drug Name |
Pemirolast |
| Drug ID |
BADD_D01703 |
| Description |
Pemirolast potassium is a slightly yellow powder that is soluble in water. It is a mast cell stabilizer that acts as an antiallergic agent. As an ophthalmic aqueous sterile solution, pemirolast is used for the prevention of itching of the eyes caused by allergies such as hay fever, and allergic conjunctivitis. Pemirolast is potentially useful for prophylaxis of pulmonary hypersensitivity reactions to drugs such as paclitaxel. |
| Indications and Usage |
For the prevention of itching of the eyes caused by allergies such as hay fever, and allergic conjunctivitis |
| Marketing Status |
approved; investigational |
| ATC Code |
Not Available |
| DrugBank ID |
DB00885
|
| KEGG ID |
D07476
|
| MeSH ID |
C055139
|
| PubChem ID |
57697
|
| TTD Drug ID |
D0K5LQ
|
| NDC Product Code |
Not Available |
| UNII |
2C09NV773M
|
| Synonyms |
pemirolast | 9-methyl-3-(1H-tetrazol-5-yl)-4H-pyrido(1,2-a)pyrimidin-4-one | pemirolast potassium salt | BMY 26517 | BMY-26517 | 9-TBX | Alamast |
|
| Chemical Information |
| Molecular Formula |
C10H8N6O |
| CAS Registry Number |
69372-19-6 |
| SMILES |
CC1=CC=CN2C1=NC=C(C2=O)C3=NNN=N3 |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice..
|
|
|