| Pharmaceutical Information | 
				
					| 
							
								| Drug Name | Arginine hydrochloride |  
								| Drug ID | BADD_D00163 |  
								| Description | An essential amino acid that is physiologically active in the L-form. |  
								| Indications and Usage | Used for nutritional supplementation, also for treating dietary shortage or imbalance. |  
								| Marketing Status | investigational; nutraceutical |  
								| ATC Code | B05XB01 |  
								| DrugBank ID | DB00125 |  
								| KEGG ID | D01126; D06483 |  
								| MeSH ID | D001120 |  
								| PubChem ID | 66250 |  
								| TTD Drug ID | D0F5DO |  
								| NDC Product Code | 0009-0436 |  
								| UNII | F7LTH1E20Y |  
								| Synonyms | Arginine | L-Arginine | L Arginine | Arginine, L-Isomer | Arginine, L Isomer | L-Isomer Arginine | DL-Arginine Acetate, Monohydrate | DL Arginine Acetate, Monohydrate | Monohydrate DL-Arginine Acetate | Arginine Hydrochloride | Hydrochloride, Arginine |  | 
				
					| Chemical Information | 
				
					| 
							
								| Molecular Formula | C6H15ClN4O2 |  
								| CAS Registry Number | 15595-35-4 |  
								| SMILES | C(CC(C(=O)O)N)CN=C(N)N.Cl |  
								| Chemical Structure |   |  | 
				
					| ADRs Induced by Drug | 
                
                    |  | 
				
					| *The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
					
						**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice.. | 
				
					|  |