| Pharmaceutical Information |
| Drug Name |
Metolazone |
| Drug ID |
BADD_D01444 |
| Description |
A quinazoline-sulfonamide that is considered a thiazide-like diuretic which is long-acting so useful in chronic renal failure. It also tends to lower blood pressure and increase potassium loss. |
| Indications and Usage |
For the treatment of hypertension, alone or in combination with other antihypertensive drugs of a different class. |
| Marketing Status |
approved |
| ATC Code |
C03BA08 |
| DrugBank ID |
DB00524
|
| KEGG ID |
D00431
|
| MeSH ID |
D008788
|
| PubChem ID |
4170
|
| TTD Drug ID |
D01WLC
|
| NDC Product Code |
64330-115; 46708-532; 51407-431; 51407-432; 0527-2217; 72888-053; 72888-054; 76385-136; 10135-765; 50742-351; 51079-023; 60687-624; 62332-532; 71406-113; 71406-115; 65392-2201; 0185-0055; 51079-024; 63629-7875; 0527-2215; 71335-1944; 72888-052; 69575-4023; 60687-635; 0378-6172; 69292-562; 0527-2216; 71406-114; 46708-534; 63629-8733; 71610-285; 76385-137; 43353-999; 0185-5050; 62332-534; 69292-564; 69292-566; 69766-067; 0185-5600; 50742-350; 51407-433; 63629-8722; 0378-6173; 0904-6916; 17381-254; 0904-7138; 10135-767; 43353-931; 50742-349; 62332-533; 0378-6174; 71610-142; 76385-138; 43353-890; 0904-7139; 10135-766; 46708-533 |
| UNII |
TZ7V40X7VX
|
| Synonyms |
Metolazone | Microx | Mykrox | Zaroxolyn | Diulo | SR-720-22 | SR 720 22 | SR72022 |
|
| Chemical Information |
| Molecular Formula |
C16H16ClN3O3S |
| CAS Registry Number |
17560-51-9 |
| SMILES |
CC1NC2=CC(=C(C=C2C(=O)N1C3=CC=CC=C3C)S(=O)(=O)N)Cl |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice..
|
|
|