| Pharmaceutical Information |
| Drug Name |
Lamivudine |
| Drug ID |
BADD_D01242 |
| Description |
A reverse transcriptase inhibitor and zalcitabine analog in which a sulfur atom replaces the 3' carbon of the pentose ring. It is used to treat Human Immunodeficiency Virus Type 1 (HIV-1) and hepatitis B (HBV). |
| Indications and Usage |
For the treatment of HIV infection and chronic hepatitis B (HBV). |
| Marketing Status |
approved; investigational |
| ATC Code |
J05AF05 |
| DrugBank ID |
DB00709
|
| KEGG ID |
D00353
|
| MeSH ID |
D019259
|
| PubChem ID |
60825
|
| TTD Drug ID |
D07TQV
|
| NDC Product Code |
65015-756; 49702-203; 60687-362; 53873-075; 49702-205; 69097-167; 42385-714; 52482-003; 70966-0036; 0173-0663; 65862-055; 60505-3252; 65862-026; 69097-166; 53873-073; 55773-0589; 68554-0043; 31722-001; 49702-204; 64380-710; 68554-0016; 31722-752; 31722-754; 50742-624; 60687-720; 64380-711; 68180-602; 53104-7677; 70159-001; 31722-753; 54838-566; 57237-274; 60429-354; 66993-478; 68180-603; 53104-7538; 65015-701; 67835-0017; 60505-3250; 0904-6583; 53873-074; 65862-577; 33342-001; 0173-0662; 60505-3251; 65862-259; 65862-025; 82245-0204; 33342-002; 50742-623; 60429-353 |
| UNII |
2T8Q726O95
|
| Synonyms |
Lamivudine | 3TC | 2',3'-Dideoxy-3'-thiacytidine | 2',3' Dideoxy 3' thiacytidine | Epivir | Lamivudine, (2S-cis)-Isomer | BCH-189 | BCH 189 | BCH189 | GR-109714X | GR109714X |
|
| Chemical Information |
| Molecular Formula |
C8H11N3O3S |
| CAS Registry Number |
134678-17-4 |
| SMILES |
C1C(OC(S1)CO)N2C=CC(=NC2=O)N |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice..
|
|
|