| Pharmaceutical Information |
| Drug Name |
Idoxuridine |
| Drug ID |
BADD_D01131 |
| Description |
An analog of deoxyuridine that inhibits viral DNA synthesis. The drug is used as an antiviral agent. |
| Indications and Usage |
For use in keratoconjunctivitis and keratitis caused by herpes simplex virus. |
| Marketing Status |
approved; investigational |
| ATC Code |
D06BB01; J05AB02; S01AD01 |
| DrugBank ID |
DB00249
|
| KEGG ID |
D00342
|
| MeSH ID |
D007065
|
| PubChem ID |
5905
|
| TTD Drug ID |
D09PZO
|
| NDC Product Code |
Not Available |
| UNII |
LGP81V5245
|
| Synonyms |
Idoxuridine | 5-Iodo-2'-deoxyuridine | 5 Iodo 2' deoxyuridine | IUdR | 5-Iododeoxyuridine | 5 Iododeoxyuridine | Iododeoxyuridine | Herplex Liquifilm | Liquifilm, Herplex | Idoxuridine, 123I-Labeled | 123I-Labeled Idoxuridine | Idoxuridine, 123I Labeled | Idoxuridine, 125I-Labeled | 125I-Labeled Idoxuridine | Idoxuridine, 125I Labeled | Idoxuridine, 131I-Labeled | 131I-Labeled Idoxuridine | Idoxuridine, 131I Labeled | Idoxuridine, 3H-Labeled | 3H-Labeled Idoxuridine | Idoxuridine, 3H Labeled | Stoxil | Idoxuridine, Radical Ion (1-) | Kerecide | NSC-39661 | NSC 39661 | NSC39661 | Oftan-IDU | Oftan IDU | OftanIDU | SK&F-14287 | Allergan 211 | Idoxuridine, Radical Ion (+1) |
|
| Chemical Information |
| Molecular Formula |
C9H11IN2O5 |
| CAS Registry Number |
54-42-2 |
| SMILES |
C1C(C(OC1N2C=C(C(=O)NC2=O)I)CO)O |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice..
|
|
|