| Pharmaceutical Information |
| Drug Name |
Flunisolide hemihydrate |
| Drug ID |
BADD_D00921 |
| Description |
Flunisolide (marketed as AeroBid, Nasalide, Nasarel) is a corticosteroid with anti-inflammatory actions. It is often prescribed as treatment for allergic rhinitis and its principle mechanism of action involves activation of glucocorticoid receptors. |
| Indications and Usage |
For the maintenance treatment of asthma as a prophylactic therapy. |
| Marketing Status |
approved; investigational |
| ATC Code |
R01AD04; R03BA03 |
| DrugBank ID |
DB00180
|
| KEGG ID |
D00324; D04214
|
| MeSH ID |
C007734
|
| PubChem ID |
82153
|
| TTD Drug ID |
D0FM2P
|
| NDC Product Code |
46439-8740; 51927-1794; 50742-317; 24208-344 |
| UNII |
78M02AA8KF
|
| Synonyms |
flunisolide | flunisolide anhydrous | 6alpha-fluoro-11beta,16alpha,17,21-tetrahydroxypregna-1,4-diene-3,20-dione cyclic 16, 17-acetal with acetone | 6 alpha-fluorodihydroxy-16 alpha,17 alpha-isopropylidenedioxy-1,4-pregnadiene-3,20- dione | flunisolide hemihydrate | flunisolide hemihydrate, (6alpha,11beta,16alpha)-isomer | Nasarel | AeroBid | Aerospan | RS-3999 | Nasalide | flunisolide acetate | RS-1320 | RS1320 | flunisolide 21-acetate | flunisolide, (6beta,11beta,16alpha)-isomer | ratio-Flunisolide | Rhinalar | Syntaris | flunisolide HFA | flunisolide hydrofluoroalkane | Apo-Flunisolide | Inhacort |
|
| Chemical Information |
| Molecular Formula |
C24H31FO6 |
| CAS Registry Number |
3385-03-3 |
| SMILES |
CC1(OC2CC3C4CC(C5=CC(=O)C=CC5(C4C(CC3(C2(O1)C(=O)CO)C)O)C)F)C |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice..
|
|
|