| Pharmaceutical Information |
| Drug Name |
Epinastine |
| Drug ID |
BADD_D00780 |
| Description |
Epinastine is used for the prevention of itching associated with allergic conjunctivitis. It has a multi-action effect that inhibits the allergic response in 3 ways: 1. stabilizes mast cells by preventing mast cell degranulation to control the allergic response, 2. prevents histamine binding to both the H1- and H2-receptors to stop itching and provide lasting protection, and 3. prevents the release of proinflammatory chemical mediators from the blood vessel to halt progression of the allergic response. |
| Indications and Usage |
For the prevention of itching associated with allergic conjunctivitis. |
| Marketing Status |
Prescription |
| ATC Code |
R06AX24; S01GX10 |
| DrugBank ID |
DB00751
|
| KEGG ID |
D07900
|
| MeSH ID |
C053090
|
| PubChem ID |
3241
|
| TTD Drug ID |
D0DV3O
|
| NDC Product Code |
Not Available |
| Synonyms |
epinastine | 3-amino-9,13b-dihydro-1H-benz(c,f)imidazo(1,5a)azepine | Flurinol | WAL-80 Cl | WAL 801 | WAL 801 CL | WAL 801CL | epinastine hydrochloride | WAL 80 |
|
| Chemical Information |
| Molecular Formula |
C16H15N3 |
| CAS Registry Number |
80012-43-7 |
| SMILES |
C1C2C3=CC=CC=C3CC4=CC=CC=C4N2C(=N1)N |
| Chemical Structure |
|
|
| ADR Related Proteins Induced by Drug |
| ADR Term |
Protein Name |
UniProt AC |
TTD Target ID |
PMID |
| Not Available | Not Available | Not Available | Not Available | Not Available |
|
| ADRs Induced by Drug |
|
|
