| Pharmaceutical Information |
| Drug Name |
Demeclocycline |
| Drug ID |
BADD_D00605 |
| Description |
A tetracycline analog having a 7-chloro and a 6-methyl. Because it is excreted more slowly than tetracycline, it maintains effective blood levels for longer periods of time. |
| Indications and Usage |
Used primarily to treat Lyme disease, acne, and bronchitis. Also indicated (but rarely used) to treat urinary tract infections, gum disease, malaria, and other bacterial infections such as gonorrhea and chlamydia. One of its other registered uses is the treatment of hyponatremia (low blood sodium concentration) due to the syndrome of inappropriate antidiuretic hormone (SIADH) where fluid restriction alone has been ineffective. |
| Marketing Status |
approved |
| ATC Code |
D06AA01; J01AA01 |
| DrugBank ID |
DB00618
|
| KEGG ID |
D03680
|
| MeSH ID |
D003707
|
| PubChem ID |
54680690
|
| TTD Drug ID |
D0R9WP
|
| NDC Product Code |
53746-554; 60687-691; 65162-555; 53746-555; 60687-705; 65162-554 |
| UNII |
5R5W9ICI6O
|
| Synonyms |
Demeclocycline | Demethylchlortetracycline | Declomycin | Lédermycine | Ledermycin | Demeclocycline, Calcium (1:1) Salt | Demeclocycline Monohydrochloride | Monohydrochloride, Demeclocycline | Demeclocycline, 4-epimer | Demeclocycline, Calcium (1:2) Salt | Demeclocycline Hydrochloride | Hydrochloride, Demeclocycline |
|
| Chemical Information |
| Molecular Formula |
C21H21ClN2O8 |
| CAS Registry Number |
127-33-3 |
| SMILES |
CN(C)C1C2CC3C(C4=C(C=CC(=C4C(=C3C(=O)C2(C(=C(C1=O)C(=O)N)O)O)O)O)Cl)O |
| Chemical Structure |
|
|
| ADRs Induced by Drug |
|
|
*The priority for ADR severity classification is based on FAERS assessment, followed by the most severe level in CTCAE rating. If neither is available, it will be displayed as 'Not available'.
**The 'Not Available' level is hidden by default and can be restored by clicking on the legend twice..
|
|
|